C19H24N4O — CID 74659521
phenyl-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 74659521) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is phenyl-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | phenyl-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 74659521 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | phenyl-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCCC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C19H24N4O/c24-19(15-8-3-1-4-9-15)22-12-7-10-16(14-22)18-21-20-17-11-5-2-6-13-23(17)18/h1,3-4,8-9,16H,2,5-7,10-14H2 |
| InChIKey | GXGOTTGIKWNGDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |