C21H25N5O — CID 51933582
1H-indol-2-yl-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 51933582) has the molecular formula C21H25N5O and a molecular weight of 363.46 g/mol. Its IUPAC name is 1H-indol-2-yl-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51933582 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1H-indol-2-yl-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCC[C@H](c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C21H25N5O/c27-21(18-13-15-7-3-4-9-17(15)22-18)25-11-6-8-16(14-25)20-24-23-19-10-2-1-5-12-26(19)20/h3-4,7,9,13,16,22H,1-2,5-6,8,10-12,14H2/t16-/m0/s1 |
| InChIKey | MGYHOOIJLJJMNE-INIZCTEOSA-N |
| XLogP | 3.51 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |