C21H24FN5O — CID 134003167
(4-fluoro-1H-indol-2-yl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 134003167) has the molecular formula C21H24FN5O and a molecular weight of 381.46 g/mol. Its IUPAC name is (4-fluoro-1H-indol-2-yl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4-fluoro-1H-indol-2-yl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134003167 |
| Molecular Formula | C21H24FN5O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | (4-fluoro-1H-indol-2-yl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2c(F)cccc2[nH]1)N1CCCC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C21H24FN5O/c22-16-7-4-8-17-15(16)12-18(23-17)21(28)26-10-5-6-14(13-26)20-25-24-19-9-2-1-3-11-27(19)20/h4,7-8,12,14,23H,1-3,5-6,9-11,13H2 |
| InChIKey | JYAOTHIXAQZNIA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |