C20H25FN4O2 — CID 55555717
(2-fluoro-4-methoxyphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 55555717) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-fluoro-4-methoxyphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55555717 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)c(F)c1 |
| InChI | InChI=1S/C20H25FN4O2/c1-27-15-8-9-16(17(21)12-15)20(26)24-10-5-6-14(13-24)19-23-22-18-7-3-2-4-11-25(18)19/h8-9,12,14H,2-7,10-11,13H2,1H3 |
| InChIKey | HGOUBMWIRPTPKF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |