C17H22N4OS — CID 31403281
[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 31403281) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 31403281 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC[C@H](c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C17H22N4OS/c22-17(14-7-10-23-12-14)20-8-4-5-13(11-20)16-19-18-15-6-2-1-3-9-21(15)16/h7,10,12-13H,1-6,8-9,11H2/t13-/m0/s1 |
| InChIKey | SIQXYRKLUQWEPJ-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |