C26H37N5O3S — CID 55488823
N-cyclohexyl-N-methyl-4-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 55488823) has the molecular formula C26H37N5O3S and a molecular weight of 499.68 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55488823 |
| Molecular Formula | C26H37N5O3S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)cc1 |
| InChI | InChI=1S/C26H37N5O3S/c1-29(22-10-4-2-5-11-22)35(33,34)23-15-13-20(14-16-23)26(32)30-17-8-9-21(19-30)25-28-27-24-12-6-3-7-18-31(24)25/h13-16,21-22H,2-12,17-19H2,1H3 |
| InChIKey | QTGCDZCWBBVZHS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |