C24H32N4O3 — CID 55556391
[4-(oxolan-2-ylmethoxy)phenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 55556391) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is [4-(oxolan-2-ylmethoxy)phenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(oxolan-2-ylmethoxy)phenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55556391 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [4-(oxolan-2-ylmethoxy)phenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCC2CCCO2)cc1)N1CCCC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C24H32N4O3/c29-24(18-9-11-20(12-10-18)31-17-21-7-5-15-30-21)27-13-4-6-19(16-27)23-26-25-22-8-2-1-3-14-28(22)23/h9-12,19,21H,1-8,13-17H2 |
| InChIKey | RGJYFPFGXFYLCO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |