C20H26N4O2 — CID 92595107
(4-methoxyphenyl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 92595107) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92595107 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (4-methoxyphenyl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(c3nnc4n3CCCCC4)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-26-17-8-6-16(7-9-17)20(25)23-13-10-15(11-14-23)19-22-21-18-5-3-2-4-12-24(18)19/h6-9,15H,2-5,10-14H2,1H3 |
| InChIKey | WXWGBFZFGJQAEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |