C19H25N5O2 — CID 92623960
(3-methoxyphenyl)-[(3R)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone (PubChem CID 92623960) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (3-methoxyphenyl)-[(3R)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[(3R)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92623960 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (3-methoxyphenyl)-[(3R)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCC[C@@H](c3nnc4n3CCNCC4)C2)c1 |
| InChI | InChI=1S/C19H25N5O2/c1-26-16-6-2-4-14(12-16)19(25)23-10-3-5-15(13-23)18-22-21-17-7-8-20-9-11-24(17)18/h2,4,6,12,15,20H,3,5,7-11,13H2,1H3/t15-/m1/s1 |
| InChIKey | YRAODNXYHTVAGV-OAHLLOKOSA-N |
| XLogP | 1.45 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |