C20H27N5O2 — CID 92623934
(2-methoxy-3-methylphenyl)-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone (PubChem CID 92623934) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is (2-methoxy-3-methylphenyl)-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-methoxy-3-methylphenyl)-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92623934 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2-methoxy-3-methylphenyl)-[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1c(C)cccc1C(=O)N1CCC[C@H](c2nnc3n2CCNCC3)C1 |
| InChI | InChI=1S/C20H27N5O2/c1-14-5-3-7-16(18(14)27-2)20(26)24-11-4-6-15(13-24)19-23-22-17-8-9-21-10-12-25(17)19/h3,5,7,15,21H,4,6,8-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | QSUXIXGDAPPFHQ-HNNXBMFYSA-N |
| XLogP | 1.76 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |