C20H22N6O — CID 92625184
isoquinolin-1-yl-[(3R)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 92625184) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is isoquinolin-1-yl-[(3R)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | isoquinolin-1-yl-[(3R)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92625184 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | isoquinolin-1-yl-[(3R)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1nccc2ccccc12)N1CCC[C@@H](c2nnc3n2CCNC3)C1 |
| InChI | InChI=1S/C20H22N6O/c27-20(18-16-6-2-1-4-14(16)7-8-22-18)25-10-3-5-15(13-25)19-24-23-17-12-21-9-11-26(17)19/h1-2,4,6-8,15,21H,3,5,9-13H2/t15-/m1/s1 |
| InChIKey | FCNJXWPYQXQIAV-OAHLLOKOSA-N |
| XLogP | 1.95 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |