C21H30N6 — CID 92625224
3-[(3R)-1-[(2-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 92625224) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-[(3R)-1-[(2-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[(3R)-1-[(2-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 92625224 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 3-[(3R)-1-[(2-pyrrolidin-1-ylphenyl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | c1ccc(N2CCCC2)c(CN2CCC[C@@H](c3nnc4n3CCNC4)C2)c1 |
| InChI | InChI=1S/C21H30N6/c1-2-8-19(26-11-3-4-12-26)17(6-1)15-25-10-5-7-18(16-25)21-24-23-20-14-22-9-13-27(20)21/h1-2,6,8,18,22H,3-5,7,9-16H2/t18-/m1/s1 |
| InChIKey | MBMNVZVPRWYEKX-GOSISDBHSA-N |
| XLogP | 2.36 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |