C16H19FN2O — CID 47151027
(3,5-dimethylpiperidin-1-yl)-(4-fluoro-1H-indol-2-yl)methanone (PubChem CID 47151027) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is (3,5-dimethylpiperidin-1-yl)-(4-fluoro-1H-indol-2-yl)methanone.
| Compound Name | (3,5-dimethylpiperidin-1-yl)-(4-fluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 47151027 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (3,5-dimethylpiperidin-1-yl)-(4-fluoro-1H-indol-2-yl)methanone |
| SMILES | CC1CC(C)CN(C(=O)c2cc3c(F)cccc3[nH]2)C1 |
| InChI | InChI=1S/C16H19FN2O/c1-10-6-11(2)9-19(8-10)16(20)15-7-12-13(17)4-3-5-14(12)18-15/h3-5,7,10-11,18H,6,8-9H2,1-2H3 |
| InChIKey | RSNLKRFSWYBVDH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |