C18H21ClN2O — CID 119381362
(3-aminopiperidin-1-yl)-(4-phenylphenyl)methanone;hydrochloride (PubChem CID 119381362) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(4-phenylphenyl)methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(4-phenylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119381362 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(4-phenylphenyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C18H20N2O.ClH/c19-17-7-4-12-20(13-17)18(21)16-10-8-15(9-11-16)14-5-2-1-3-6-14;/h1-3,5-6,8-11,17H,4,7,12-13,19H2;1H |
| InChIKey | IXFIDDIQZVABLX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |