C20H23N3O — CID 118781040
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrimidin-5-ylphenyl)methanone (PubChem CID 118781040) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrimidin-5-ylphenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrimidin-5-ylphenyl)methanone |
|---|---|
| PubChem CID | 118781040 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrimidin-5-ylphenyl)methanone |
| SMILES | O=C(c1cccc(-c2cncnc2)c1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C20H23N3O/c24-20(23-9-8-15-4-1-2-5-18(15)13-23)17-7-3-6-16(10-17)19-11-21-14-22-12-19/h3,6-7,10-12,14-15,18H,1-2,4-5,8-9,13H2/t15-,18-/m0/s1 |
| InChIKey | HEHNZECQSNYLJC-YJBOKZPZSA-N |
| XLogP | 3.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |