C19H31ClN4O3S — CID 139937742
4-chloro-N-[4-[2-(cyclohexylamino)ethylamino]butyl]-3-sulfamoylbenzamide (PubChem CID 139937742) has the molecular formula C19H31ClN4O3S and a molecular weight of 431.00 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-(cyclohexylamino)ethylamino]butyl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[4-[2-(cyclohexylamino)ethylamino]butyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 139937742 |
| Molecular Formula | C19H31ClN4O3S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-chloro-N-[4-[2-(cyclohexylamino)ethylamino]butyl]-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCCCNCCNC2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C19H31ClN4O3S/c20-17-9-8-15(14-18(17)28(21,26)27)19(25)24-11-5-4-10-22-12-13-23-16-6-2-1-3-7-16/h8-9,14,16,22-23H,1-7,10-13H2,(H,24,25)(H2,21,26,27) |
| InChIKey | XMFKJNQQMNLFIF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|