C15H15Br2NOS — CID 103603306
2,6-dibromo-4-[(2-phenylsulfanylethylamino)methyl]phenol (PubChem CID 103603306) has the molecular formula C15H15Br2NOS and a molecular weight of 417.17 g/mol. Its IUPAC name is 2,6-dibromo-4-[(2-phenylsulfanylethylamino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(2-phenylsulfanylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 103603306 |
| Molecular Formula | C15H15Br2NOS |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 2,6-dibromo-4-[(2-phenylsulfanylethylamino)methyl]phenol |
| SMILES | Oc1c(Br)cc(CNCCSc2ccccc2)cc1Br |
| InChI | InChI=1S/C15H15Br2NOS/c16-13-8-11(9-14(17)15(13)19)10-18-6-7-20-12-4-2-1-3-5-12/h1-5,8-9,18-19H,6-7,10H2 |
| InChIKey | GBGZJTFARXOWQM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|