C18H21Br2NO2 — CID 167774945
2,6-dibromo-4-[[(3-hydroxy-5-phenylpentyl)amino]methyl]phenol (PubChem CID 167774945) has the molecular formula C18H21Br2NO2 and a molecular weight of 443.18 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(3-hydroxy-5-phenylpentyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(3-hydroxy-5-phenylpentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 167774945 |
| Molecular Formula | C18H21Br2NO2 |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2,6-dibromo-4-[[(3-hydroxy-5-phenylpentyl)amino]methyl]phenol |
| SMILES | Oc1c(Br)cc(CNCCC(O)CCc2ccccc2)cc1Br |
| InChI | InChI=1S/C18H21Br2NO2/c19-16-10-14(11-17(20)18(16)23)12-21-9-8-15(22)7-6-13-4-2-1-3-5-13/h1-5,10-11,15,21-23H,6-9,12H2 |
| InChIKey | IZYNARDWNFVBNA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|