C13H21NO3 — CID 28674357
N-[(3,5-dimethoxyphenyl)methyl]-3-methoxypropan-1-amine (PubChem CID 28674357) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 28674357 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-3-methoxypropan-1-amine |
| SMILES | COCCCNCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H21NO3/c1-15-6-4-5-14-10-11-7-12(16-2)9-13(8-11)17-3/h7-9,14H,4-6,10H2,1-3H3 |
| InChIKey | PCYKTVJUWRRCJA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|