C16H28N2O2 — CID 115572730
N'-tert-butyl-N-[(3,5-dimethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 115572730) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N'-tert-butyl-N-[(3,5-dimethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-[(3,5-dimethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 115572730 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N'-tert-butyl-N-[(3,5-dimethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cc(CNCCCNC(C)(C)C)cc(OC)c1 |
| InChI | InChI=1S/C16H28N2O2/c1-16(2,3)18-8-6-7-17-12-13-9-14(19-4)11-15(10-13)20-5/h9-11,17-18H,6-8,12H2,1-5H3 |
| InChIKey | XLWKHJOSFBFHMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|