C12H20N2O3S — CID 114174793
2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-N-methylethanesulfonamide (PubChem CID 114174793) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 114174793 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9-6-11(7-10(2)12(9)15)8-14-4-5-18(16,17)13-3/h6-7,13-15H,4-5,8H2,1-3H3 |
| InChIKey | MPNZYMLBJKNTRH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|