C20H27ClFNO3 — CID 17211553
5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211553) has the molecular formula C20H27ClFNO3 and a molecular weight of 383.89 g/mol. Its IUPAC name is 5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211553 |
| Molecular Formula | C20H27ClFNO3 |
| Molecular Weight | 383.89 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]pentan-1-ol;hydrochloride |
| SMILES | COc1cc(CNCCCCCO)ccc1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C20H26FNO3.ClH/c1-24-20-13-17(14-22-11-3-2-4-12-23)7-10-19(20)25-15-16-5-8-18(21)9-6-16;/h5-10,13,22-23H,2-4,11-12,14-15H2,1H3;1H |
| InChIKey | KFCUQVUPQQWPGN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|