C23H26ClNO4 — CID 72688424
3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(4-hydroxypiperidin-1-yl)phenyl]prop-2-en-1-one (PubChem CID 72688424) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(4-hydroxypiperidin-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(4-hydroxypiperidin-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72688424 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(4-hydroxypiperidin-1-yl)phenyl]prop-2-en-1-one |
| SMILES | CCOc1cc(C=CC(=O)c2ccc(N3CCC(O)CC3)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H26ClNO4/c1-3-29-22-15-16(14-20(24)23(22)28-2)4-9-21(27)17-5-7-18(8-6-17)25-12-10-19(26)11-13-25/h4-9,14-15,19,26H,3,10-13H2,1-2H3 |
| InChIKey | GBHKOBNJMMYYQQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|