C15H21N3O4 — CID 31844781
ethyl 4-[(6-methoxypyridine-3-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 31844781) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 4-[(6-methoxypyridine-3-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(6-methoxypyridine-3-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31844781 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl 4-[(6-methoxypyridine-3-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccc(OC)nc2)CC1 |
| InChI | InChI=1S/C15H21N3O4/c1-3-22-15(20)18-8-6-12(7-9-18)17-14(19)11-4-5-13(21-2)16-10-11/h4-5,10,12H,3,6-9H2,1-2H3,(H,17,19) |
| InChIKey | FQCKIBZVGQESLE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |