C17H24N2O5S — CID 110625200
N-[2-(cyclohexylamino)-2-oxoethyl]-4-methoxy-3-methylsulfonylbenzamide (PubChem CID 110625200) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxoethyl]-4-methoxy-3-methylsulfonylbenzamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxoethyl]-4-methoxy-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 110625200 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxoethyl]-4-methoxy-3-methylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NC2CCCCC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C17H24N2O5S/c1-24-14-9-8-12(10-15(14)25(2,22)23)17(21)18-11-16(20)19-13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | PZFJPBITIBYWHL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |