C21H24N2O4S — CID 42924269
N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 42924269) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 42924269 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)NC2CCc3ccccc32)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C21H24N2O4S/c1-27-19-11-9-16(14-20(19)28(25,26)23-12-4-5-13-23)21(24)22-18-10-8-15-6-2-3-7-17(15)18/h2-3,6-7,9,11,14,18H,4-5,8,10,12-13H2,1H3,(H,22,24) |
| InChIKey | NFOAICSZVWDVNO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |