C20H18BrN3O3 — CID 78870406
N-[4-[[(3-bromo-4-methylphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 78870406) has the molecular formula C20H18BrN3O3 and a molecular weight of 428.29 g/mol. Its IUPAC name is N-[4-[[(3-bromo-4-methylphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(3-bromo-4-methylphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78870406 |
| Molecular Formula | C20H18BrN3O3 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[4-[[(3-bromo-4-methylphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)NCc2ccc(NC(=O)c3ccco3)cc2)cc1Br |
| InChI | InChI=1S/C20H18BrN3O3/c1-13-4-7-16(11-17(13)21)24-20(26)22-12-14-5-8-15(9-6-14)23-19(25)18-3-2-10-27-18/h2-11H,12H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | UEXBBYJATSQRQC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |