C18H21BrN2O3 — CID 78874640
1-(3-bromo-4-methylphenyl)-3-[[4-(2-methoxyethoxy)phenyl]methyl]urea (PubChem CID 78874640) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-3-[[4-(2-methoxyethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3-bromo-4-methylphenyl)-3-[[4-(2-methoxyethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78874640 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-3-[[4-(2-methoxyethoxy)phenyl]methyl]urea |
| SMILES | COCCOc1ccc(CNC(=O)Nc2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-13-3-6-15(11-17(13)19)21-18(22)20-12-14-4-7-16(8-5-14)24-10-9-23-2/h3-8,11H,9-10,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | SPFOCXAIYWXBQS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|