C22H23N3O3 — CID 42935867
N-[4-[[1-(2-methylphenyl)ethylcarbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 42935867) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[4-[[1-(2-methylphenyl)ethylcarbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[1-(2-methylphenyl)ethylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42935867 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[4-[[1-(2-methylphenyl)ethylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1C(C)NC(=O)NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-15-6-3-4-7-19(15)16(2)24-22(27)23-14-17-9-11-18(12-10-17)25-21(26)20-8-5-13-28-20/h3-13,16H,14H2,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | ORGZPSGZHYEFTR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |