C19H23N3O7S — CID 55366879
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 55366879) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 55366879 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C(NC(=O)c2ccco2)C(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H23N3O7S/c1-11(2)17(22-18(24)14-5-4-8-28-14)19(25)29-10-16(23)21-13-7-6-12(3)15(9-13)30(20,26)27/h4-9,11,17H,10H2,1-3H3,(H,21,23)(H,22,24)(H2,20,26,27) |
| InChIKey | CAAAHAKOLZOFAC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |