C21H17FN2O4 — CID 4801774
[2-(naphthalen-1-ylamino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 4801774) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4801774 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1F)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H17FN2O4/c22-17-10-4-3-9-16(17)21(27)23-12-20(26)28-13-19(25)24-18-11-5-7-14-6-1-2-8-15(14)18/h1-11H,12-13H2,(H,23,27)(H,24,25) |
| InChIKey | GIQLWACYRIRSKR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |