C26H21FN2O4 — CID 4857641
[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 4857641) has the molecular formula C26H21FN2O4 and a molecular weight of 444.46 g/mol. Its IUPAC name is [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4857641 |
| Molecular Formula | C26H21FN2O4 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)COC(=O)CNC(=O)c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C26H21FN2O4/c1-29-21-14-8-6-12-19(21)24(25(29)17-9-3-2-4-10-17)22(30)16-33-23(31)15-28-26(32)18-11-5-7-13-20(18)27/h2-14H,15-16H2,1H3,(H,28,32) |
| InChIKey | UIFSWVAEMJFXNM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |