C19H19IN2O4 — CID 55307635
[2-(3-ethylanilino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate (PubChem CID 55307635) has the molecular formula C19H19IN2O4 and a molecular weight of 466.28 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55307635 |
| Molecular Formula | C19H19IN2O4 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
| SMILES | CCc1cccc(NC(=O)COC(=O)CNC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C19H19IN2O4/c1-2-13-6-5-7-14(10-13)22-17(23)12-26-18(24)11-21-19(25)15-8-3-4-9-16(15)20/h3-10H,2,11-12H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | NFNZKRLGOMSXHG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|