C20H23N3O4 — CID 7805318
[2-(3-ethylanilino)-2-oxoethyl] 3-(phenylcarbamoylamino)propanoate (PubChem CID 7805318) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] 3-(phenylcarbamoylamino)propanoate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] 3-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 7805318 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] 3-(phenylcarbamoylamino)propanoate |
| SMILES | CCc1cccc(NC(=O)COC(=O)CCNC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-2-15-7-6-10-17(13-15)22-18(24)14-27-19(25)11-12-21-20(26)23-16-8-4-3-5-9-16/h3-10,13H,2,11-12,14H2,1H3,(H,22,24)(H2,21,23,26) |
| InChIKey | RVBNKSXOVVPJDC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |