C19H27N3O6S — CID 7806947
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-piperidin-1-ylsulfonylbenzoate (PubChem CID 7806947) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7806947 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H27N3O6S/c1-3-14(2)20-19(25)21-17(23)13-28-18(24)15-9-5-6-10-16(15)29(26,27)22-11-7-4-8-12-22/h5-6,9-10,14H,3-4,7-8,11-13H2,1-2H3,(H2,20,21,23,25)/t14-/m1/s1 |
| InChIKey | LJFHFCCRRLGCHG-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |