C22H24N2O3 — CID 8816197
[2-(2,6-diethylanilino)-2-oxoethyl] 1-methylindole-3-carboxylate (PubChem CID 8816197) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 1-methylindole-3-carboxylate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 8816197 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-methylindole-3-carboxylate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-4-15-9-8-10-16(5-2)21(15)23-20(25)14-27-22(26)18-13-24(3)19-12-7-6-11-17(18)19/h6-13H,4-5,14H2,1-3H3,(H,23,25) |
| InChIKey | XPNQCOJUHRYDSN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |