C18H20FNO3S — CID 9309655
[(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 9309655) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 9309655 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 5-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc2cc(F)ccc2s1)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H20FNO3S/c1-12(17(21)20-8-4-2-3-5-9-20)23-18(22)16-11-13-10-14(19)6-7-15(13)24-16/h6-7,10-12H,2-5,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | XBGWFQZARQLVIL-GFCCVEGCSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |