C14H11Cl3N4OS — CID 142079984
1-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethyl]-3-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 142079984) has the molecular formula C14H11Cl3N4OS and a molecular weight of 389.70 g/mol. Its IUPAC name is 1-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethyl]-3-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethyl]-3-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 142079984 |
| Molecular Formula | C14H11Cl3N4OS |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 1-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethyl]-3-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | C=Nc1ccc(Cl)cc1SCNC(=O)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3N4OS/c1-18-10-3-2-8(15)4-11(10)23-7-19-14(22)20-9-5-12(16)21-13(17)6-9/h2-6H,1,7H2,(H2,19,20,21,22) |
| InChIKey | PRLYKBRRTAVYFP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|