C12H16N2O6 — CID 66167135
3-[(3,4-dimethoxyphenyl)carbamoylamino]-2-hydroxypropanoic acid (PubChem CID 66167135) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)carbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(3,4-dimethoxyphenyl)carbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66167135 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)carbamoylamino]-2-hydroxypropanoic acid |
| SMILES | COc1ccc(NC(=O)NCC(O)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H16N2O6/c1-19-9-4-3-7(5-10(9)20-2)14-12(18)13-6-8(15)11(16)17/h3-5,8,15H,6H2,1-2H3,(H,16,17)(H2,13,14,18) |
| InChIKey | FUMCTLDAXRSUPA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |