C18H22N2O3 — CID 51944503
1-(3,4-dimethoxyphenyl)-3-[(2S)-2-phenylpropyl]urea (PubChem CID 51944503) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(2S)-2-phenylpropyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(2S)-2-phenylpropyl]urea |
|---|---|
| PubChem CID | 51944503 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(2S)-2-phenylpropyl]urea |
| SMILES | COc1ccc(NC(=O)NC[C@@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-13(14-7-5-4-6-8-14)12-19-18(21)20-15-9-10-16(22-2)17(11-15)23-3/h4-11,13H,12H2,1-3H3,(H2,19,20,21)/t13-/m1/s1 |
| InChIKey | HVINIDMEOGGTTR-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |