C19H18N2O3 — CID 53067289
N-(2,4-dimethylphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide (PubChem CID 53067289) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 53067289 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide |
| SMILES | C=CCn1c(=O)oc2ccc(C(=O)Nc3ccc(C)cc3C)cc21 |
| InChI | InChI=1S/C19H18N2O3/c1-4-9-21-16-11-14(6-8-17(16)24-19(21)23)18(22)20-15-7-5-12(2)10-13(15)3/h4-8,10-11H,1,9H2,2-3H3,(H,20,22) |
| InChIKey | XKHXKYVITCPHMR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|