C13H15N3O3 — CID 34182716
3-[2-(3-oxopiperazin-1-yl)ethyl]-1,3-benzoxazol-2-one (PubChem CID 34182716) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[2-(3-oxopiperazin-1-yl)ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-(3-oxopiperazin-1-yl)ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 34182716 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-[2-(3-oxopiperazin-1-yl)ethyl]-1,3-benzoxazol-2-one |
| SMILES | O=C1CN(CCn2c(=O)oc3ccccc32)CCN1 |
| InChI | InChI=1S/C13H15N3O3/c17-12-9-15(6-5-14-12)7-8-16-10-3-1-2-4-11(10)19-13(16)18/h1-4H,5-9H2,(H,14,17) |
| InChIKey | PVHFUCKRVJIEFO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |