C20H23N5O3 — CID 55802709
4-(2-oxo-1,3-benzoxazol-3-yl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide (PubChem CID 55802709) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide.
| Compound Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 55802709 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C20H23N5O3/c26-18(9-4-13-25-16-7-1-2-8-17(16)28-20(25)27)23-15-6-3-12-24(14-15)19-21-10-5-11-22-19/h1-2,5,7-8,10-11,15H,3-4,6,9,12-14H2,(H,23,26) |
| InChIKey | PUBPZSLNLMFLGO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |