C21H22N4O5S — CID 24637345
1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]thiourea (PubChem CID 24637345) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 24637345 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]thiourea |
| SMILES | CC1Oc2ccccc2N(CCC(=O)NNC(=S)NCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C21H22N4O5S/c1-13-20(27)25(15-4-2-3-5-16(15)30-13)9-8-19(26)23-24-21(31)22-11-14-6-7-17-18(10-14)29-12-28-17/h2-7,10,13H,8-9,11-12H2,1H3,(H,23,26)(H2,22,24,31) |
| InChIKey | YRQCJQHJLKQDRH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|