C18H19ClN4O5S2 — CID 24637335
1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]thiourea (PubChem CID 24637335) has the molecular formula C18H19ClN4O5S2 and a molecular weight of 470.96 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 24637335 |
| Molecular Formula | C18H19ClN4O5S2 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]thiourea |
| SMILES | CS(=O)(=O)N(CC(=O)NNC(=S)NCc1ccc2c(c1)OCO2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN4O5S2/c1-30(25,26)23(14-4-2-3-13(19)8-14)10-17(24)21-22-18(29)20-9-12-5-6-15-16(7-12)28-11-27-15/h2-8H,9-11H2,1H3,(H,21,24)(H2,20,22,29) |
| InChIKey | LZOSKBXRQFOARX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|