C19H21ClN2O5S2 — CID 2223195
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 2223195) has the molecular formula C19H21ClN2O5S2 and a molecular weight of 456.97 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2223195 |
| Molecular Formula | C19H21ClN2O5S2 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCSCc1cccc(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21ClN2O5S2/c1-29(24,25)22(16-5-6-17-18(10-16)27-13-26-17)11-19(23)21-7-8-28-12-14-3-2-4-15(20)9-14/h2-6,9-10H,7-8,11-13H2,1H3,(H,21,23) |
| InChIKey | SUXCRSHRPGWQMJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|