C21H26N2O5S2 — CID 30248651
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30248651) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30248651 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[3-[(2-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccccc1CSCCCNC(=O)CN(c1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C21H26N2O5S2/c1-16-6-3-4-7-17(16)14-29-11-5-10-22-21(24)13-23(30(2,25)26)18-8-9-19-20(12-18)28-15-27-19/h3-4,6-9,12H,5,10-11,13-15H2,1-2H3,(H,22,24) |
| InChIKey | FOULARUYFXAYLY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|