C18H20BrClN2O3S2 — CID 51342686
2-(4-bromo-N-methylsulfonylanilino)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 51342686) has the molecular formula C18H20BrClN2O3S2 and a molecular weight of 491.86 g/mol. Its IUPAC name is 2-(4-bromo-N-methylsulfonylanilino)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-bromo-N-methylsulfonylanilino)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 51342686 |
| Molecular Formula | C18H20BrClN2O3S2 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-(4-bromo-N-methylsulfonylanilino)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCSCc1cccc(Cl)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrClN2O3S2/c1-27(24,25)22(17-7-5-15(19)6-8-17)12-18(23)21-9-10-26-13-14-3-2-4-16(20)11-14/h2-8,11H,9-10,12-13H2,1H3,(H,21,23) |
| InChIKey | MEIYOGDSAWGDSJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|