C17H18FN5O2S2 — CID 8943014
1-[(4-fluorophenyl)methyl]-3-[[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]amino]thiourea (PubChem CID 8943014) has the molecular formula C17H18FN5O2S2 and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8943014 |
| Molecular Formula | C17H18FN5O2S2 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]amino]thiourea |
| SMILES | O=C(Cc1csc(N2CCCC2=O)n1)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN5O2S2/c18-12-5-3-11(4-6-12)9-19-16(26)22-21-14(24)8-13-10-27-17(20-13)23-7-1-2-15(23)25/h3-6,10H,1-2,7-9H2,(H,21,24)(H2,19,22,26) |
| InChIKey | KJPPZPYSVMZQFP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|