C21H26ClN5O4S — CID 55937523
4-chloro-N-[(2S,3S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide (PubChem CID 55937523) has the molecular formula C21H26ClN5O4S and a molecular weight of 479.99 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(2S,3S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 55937523 |
| Molecular Formula | C21H26ClN5O4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-chloro-N-[(2S,3S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H26ClN5O4S/c1-3-13(2)17(24-18(28)14-4-6-15(22)7-5-14)20(30)26-25-19(29)16-12-32-21(23-16)27-8-10-31-11-9-27/h4-7,12-13,17H,3,8-11H2,1-2H3,(H,24,28)(H,25,29)(H,26,30)/t13-,17-/m0/s1 |
| InChIKey | GRNRHLYVPRVHAI-GUYCJALGSA-N |
| XLogP | 2.24 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|